C18H24N2 — CID 105340471
[(3,4-dimethylphenyl)-(3-propylphenyl)methyl]hydrazine (PubChem CID 105340471) has the molecular formula C18H24N2 and a molecular weight of 268.40 g/mol. Its IUPAC name is [(3,4-dimethylphenyl)-(3-propylphenyl)methyl]hydrazine.
| Compound Name | [(3,4-dimethylphenyl)-(3-propylphenyl)methyl]hydrazine |
|---|---|
| PubChem CID | 105340471 |
| Molecular Formula | C18H24N2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | [(3,4-dimethylphenyl)-(3-propylphenyl)methyl]hydrazine |
| SMILES | CCCc1cccc(C(NN)c2ccc(C)c(C)c2)c1 |
| InChI | InChI=1S/C18H24N2/c1-4-6-15-7-5-8-16(12-15)18(20-19)17-10-9-13(2)14(3)11-17/h5,7-12,18,20H,4,6,19H2,1-3H3 |
| InChIKey | CVZNLPIFCRLMKA-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|