C16H18F2N2O — CID 105340825
[1-(4-fluoro-3-methoxyphenyl)-2-(4-fluoro-2-methylphenyl)ethyl]hydrazine (PubChem CID 105340825) has the molecular formula C16H18F2N2O and a molecular weight of 292.33 g/mol. Its IUPAC name is [1-(4-fluoro-3-methoxyphenyl)-2-(4-fluoro-2-methylphenyl)ethyl]hydrazine.
| Compound Name | [1-(4-fluoro-3-methoxyphenyl)-2-(4-fluoro-2-methylphenyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105340825 |
| Molecular Formula | C16H18F2N2O |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | [1-(4-fluoro-3-methoxyphenyl)-2-(4-fluoro-2-methylphenyl)ethyl]hydrazine |
| SMILES | COc1cc(C(Cc2ccc(F)cc2C)NN)ccc1F |
| InChI | InChI=1S/C16H18F2N2O/c1-10-7-13(17)5-3-11(10)8-15(20-19)12-4-6-14(18)16(9-12)21-2/h3-7,9,15,20H,8,19H2,1-2H3 |
| InChIKey | LTMZVLZAVLKTRQ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|