C50H50O16P4 — CID 10534083
dibenzyl [(1R,4R)-4-bis(phenylmethoxy)phosphoryloxy-5,6-bis[(3-oxo-1,5-dihydro-2,4,3λ5-benzodioxaphosphepin-3-yl)oxy]cyclohex-2-en-1-yl] phosphate (PubChem CID 10534083) has the molecular formula C50H50O16P4 and a molecular weight of 1030.83 g/mol. Its IUPAC name is dibenzyl [(1R,4R)-4-bis(phenylmethoxy)phosphoryloxy-5,6-bis[(3-oxo-1,5-dihydro-2,4,3λ5-benzodioxaphosphepin-3-yl)oxy]cyclohex-2-en-1-yl] phosphate.
| Compound Name | dibenzyl [(1R,4R)-4-bis(phenylmethoxy)phosphoryloxy-5,6-bis[(3-oxo-1,5-dihydro-2,4,3λ5-benzodioxaphosphepin-3-yl)oxy]cyclohex-2-en-1-yl] phosphate |
|---|---|
| PubChem CID | 10534083 |
| Molecular Formula | C50H50O16P4 |
| Molecular Weight | 1030.83 g/mol |
| Exact Mass | 1030.20 |
| IUPAC Name | dibenzyl [(1R,4R)-4-bis(phenylmethoxy)phosphoryloxy-5,6-bis[(3-oxo-1,5-dihydro-2,4,3λ5-benzodioxaphosphepin-3-yl)oxy]cyclohex-2-en-1-yl] phosphate |
| SMILES | O=P1(OC2C(OP3(=O)OCc4ccccc4CO3)[C@H](OP(=O)(OCc3ccccc3)OCc3ccccc3)C=C[C@H]2OP(=O)(OCc2ccccc2)OCc2ccccc2)OCc2ccccc2CO1 |
| InChI | InChI=1S/C50H50O16P4/c51-67(55-31-39-17-5-1-6-18-39,56-32-40-19-7-2-8-20-40)63-47-29-30-48(64-68(52,57-33-41-21-9-3-10-22-41)58-34-42-23-11-4-12-24-42)50(66-70(54)61-37-45-27-15-16-28-46(45)38-62-70)49(47)65-69(53)59-35-43-25-13-14-26-44(43)36-60-69/h1-30,47-50H,31-38H2/t47-,48-,49?,50?/m1/s1 |
| InChIKey | WAXFBTZMOODYAC-ABWAZJKNSA-N |
| XLogP | 12.89 |
| TPSA | 179.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 70 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1030.83 |
| LogP ≤ 5 | 12.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|