C14H22N2O — CID 105341923
[1-(2,3-dihydro-1-benzofuran-7-yl)-2,2-dimethylbutyl]hydrazine (PubChem CID 105341923) has the molecular formula C14H22N2O and a molecular weight of 234.34 g/mol. Its IUPAC name is [1-(2,3-dihydro-1-benzofuran-7-yl)-2,2-dimethylbutyl]hydrazine.
| Compound Name | [1-(2,3-dihydro-1-benzofuran-7-yl)-2,2-dimethylbutyl]hydrazine |
|---|---|
| PubChem CID | 105341923 |
| Molecular Formula | C14H22N2O |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.17 |
| IUPAC Name | [1-(2,3-dihydro-1-benzofuran-7-yl)-2,2-dimethylbutyl]hydrazine |
| SMILES | CCC(C)(C)C(NN)c1cccc2c1OCC2 |
| InChI | InChI=1S/C14H22N2O/c1-4-14(2,3)13(16-15)11-7-5-6-10-8-9-17-12(10)11/h5-7,13,16H,4,8-9,15H2,1-3H3 |
| InChIKey | UYLZRBGDSRZXNR-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|