C61H86O19 — CID 10534271
CID 10534271 (PubChem CID 10534271) has the molecular formula C61H86O19 and a molecular weight of 1123.34 g/mol.
| Compound Name | CID 10534271 |
|---|---|
| PubChem CID | 10534271 |
| Molecular Formula | C61H86O19 |
| Molecular Weight | 1123.34 g/mol |
| Exact Mass | 1122.58 |
| IUPAC Name | — |
| SMILES | C=C1C[C@@H]2CCc3ccc(o3)[C@@H]3O[C@H]4CC[C@H](CC(=O)O[C@@H]5[C@@H](C)[C@@H]6O[C@@H]7C[C@]8(C[C@@H]9O[C@]%10(C[C@H](C)[C@@H]%11O[C@@H]%12CC(C(O)CO)O[C@@H]%12C[C@@H]%11O%10)C[C@H](C)[C@@H]9O8)O[C@@H]7C[C@@H]6O[C@H]5C[C@H]5O[C@@H](CC[C@@H]1O2)C[C@@H](C)C5=C)O[C@@H]4[C@H](O)[C@@H]3O |
| InChI | InChI=1S/C61H86O19/c1-27-15-35-10-12-38-28(2)16-34(68-38)8-7-33-9-13-39(67-33)59-53(66)52(65)58-40(73-59)14-11-36(70-58)17-51(64)76-57-32(6)56-47(72-46(57)18-41(69-35)31(27)5)21-45-49(75-56)24-61(77-45)25-50-55(80-61)30(4)23-60(79-50)22-29(3)54-48(78-60)20-43-44(74-54)19-42(71-43)37(63)26-62/h9,13,27,29-30,32,34-38,40-50,52-59,62-63,65-66H,2,5,7-8,10-12,14-26H2,1,3-4,6H3/t27-,29+,30+,32+,34+,35+,36-,37?,38+,40+,41-,42?,43-,44-,45-,46+,47+,48+,49-,50+,52-,53+,54+,55+,56+,57-,58+,59+,60-,61+/m1/s1 |
| InChIKey | PAHSFXGRMLZLGD-ICSXCURVSA-N |
| XLogP | 5.52 |
| TPSA | 231.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 80 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1123.34 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|