C68H74BrCuN5O2 — CID 10534287
copper 20-(4-bromophenyl)-5,10,15-tris(3,5-ditert-butylphenyl)-2-nitroporphyrin-22,24-diide (PubChem CID 10534287) has the molecular formula C68H74BrCuN5O2 and a molecular weight of 1136.82 g/mol. Its IUPAC name is copper 20-(4-bromophenyl)-5,10,15-tris(3,5-ditert-butylphenyl)-2-nitroporphyrin-22,24-diide.
| Compound Name | copper 20-(4-bromophenyl)-5,10,15-tris(3,5-ditert-butylphenyl)-2-nitroporphyrin-22,24-diide |
|---|---|
| PubChem CID | 10534287 |
| Molecular Formula | C68H74BrCuN5O2 |
| Molecular Weight | 1136.82 g/mol |
| Exact Mass | 1134.43 |
| IUPAC Name | copper 20-(4-bromophenyl)-5,10,15-tris(3,5-ditert-butylphenyl)-2-nitroporphyrin-22,24-diide |
| SMILES | CC(C)(C)c1cc(-c2c3nc(c(-c4cc(C(C)(C)C)cc(C(C)(C)C)c4)c4ccc([n-]4)c(-c4ccc(Br)cc4)c4nc(c(-c5cc(C(C)(C)C)cc(C(C)(C)C)c5)c5ccc2[n-]5)C=C4[N+](=O)[O-])C=C3)cc(C(C)(C)C)c1.[Cu+2] |
| InChI | InChI=1S/C68H74BrN5O2.Cu/c1-63(2,3)43-29-40(30-44(35-43)64(4,5)6)58-50-23-24-51(70-50)59(41-31-45(65(7,8)9)36-46(32-41)66(10,11)12)53-27-28-55(72-53)61(39-19-21-49(69)22-20-39)62-57(74(75)76)38-56(73-62)60(54-26-25-52(58)71-54)42-33-47(67(13,14)15)37-48(34-42)68(16,17)18;/h19-38H,1-18H3;/q-2;+2/b58-50-,58-52-,59-51-,59-53-,60-54-,60-56-,61-55-,62-61-; |
| InChIKey | FZFGEHHRGFWRKB-JYZYRQJJSA-N |
| XLogP | 18.73 |
| TPSA | 97.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 77 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1136.82 |
| LogP ≤ 5 | 18.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|