C12H12N2O2S2 — CID 105345290
2-[4-(1,2,4-thiadiazol-5-ylsulfanylmethyl)phenyl]propanoic acid (PubChem CID 105345290) has the molecular formula C12H12N2O2S2 and a molecular weight of 280.37 g/mol. Its IUPAC name is 2-[4-(1,2,4-thiadiazol-5-ylsulfanylmethyl)phenyl]propanoic acid.
| Compound Name | 2-[4-(1,2,4-thiadiazol-5-ylsulfanylmethyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 105345290 |
| Molecular Formula | C12H12N2O2S2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | 2-[4-(1,2,4-thiadiazol-5-ylsulfanylmethyl)phenyl]propanoic acid |
| SMILES | CC(C(=O)O)c1ccc(CSc2ncns2)cc1 |
| InChI | InChI=1S/C12H12N2O2S2/c1-8(11(15)16)10-4-2-9(3-5-10)6-17-12-13-7-14-18-12/h2-5,7-8H,6H2,1H3,(H,15,16) |
| InChIKey | PGHJBDNGPBFXFZ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |