C17H27NO3 — CID 105345879
2-[4-[[butan-2-yl(2-methoxyethyl)amino]methyl]phenyl]propanoic acid (PubChem CID 105345879) has the molecular formula C17H27NO3 and a molecular weight of 293.41 g/mol. Its IUPAC name is 2-[4-[[butan-2-yl(2-methoxyethyl)amino]methyl]phenyl]propanoic acid.
| Compound Name | 2-[4-[[butan-2-yl(2-methoxyethyl)amino]methyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 105345879 |
| Molecular Formula | C17H27NO3 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.20 |
| IUPAC Name | 2-[4-[[butan-2-yl(2-methoxyethyl)amino]methyl]phenyl]propanoic acid |
| SMILES | CCC(C)N(CCOC)Cc1ccc(C(C)C(=O)O)cc1 |
| InChI | InChI=1S/C17H27NO3/c1-5-13(2)18(10-11-21-4)12-15-6-8-16(9-7-15)14(3)17(19)20/h6-9,13-14H,5,10-12H2,1-4H3,(H,19,20) |
| InChIKey | YXVZLHNCBOTWGT-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |