About 5-(aminomethyl)-1,3-oxazolidin-2-one
5-(aminomethyl)-1,3-oxazolidin-2-one (PubChem CID 10534645) has the molecular formula C4H8N2O2
and a molecular weight of 116.12 g/mol. Its IUPAC name is 5-(aminomethyl)-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | 5-(aminomethyl)-1,3-oxazolidin-2-one |
| PubChem CID | 10534645 |
| Molecular Formula | C4H8N2O2 |
| Molecular Weight | 116.12 g/mol |
| Exact Mass | 116.06 |
| IUPAC Name | 5-(aminomethyl)-1,3-oxazolidin-2-one |
| SMILES | NCC1CNC(=O)O1 |
| InChI | InChI=1S/C4H8N2O2/c5-1-3-2-6-4(7)8-3/h3H,1-2,5H2,(H,6,7) |
| InChIKey | HUHZAMBLEKHDBP-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.12 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(aminomethyl)-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(aminomethyl)-1,3-oxazolidin-2-one?
The IUPAC name of 5-(aminomethyl)-1,3-oxazolidin-2-one (CID 10534645) is 5-(aminomethyl)-1,3-oxazolidin-2-one.
What is the SMILES notation for 5-(aminomethyl)-1,3-oxazolidin-2-one?
The canonical SMILES for 5-(aminomethyl)-1,3-oxazolidin-2-one is NCC1CNC(=O)O1.
What is the InChIKey of 5-(aminomethyl)-1,3-oxazolidin-2-one?
The InChIKey is HUHZAMBLEKHDBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8N2O2/c5-1-3-2-6-4(7)8-3/h3H,1-2,5H2,(H,6,7).
What are the key properties of 5-(aminomethyl)-1,3-oxazolidin-2-one?
5-(aminomethyl)-1,3-oxazolidin-2-one has a molecular weight of 116.12 g/mol, XLogP of -0.95, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(aminomethyl)-1,3-oxazolidin-2-one is sourced from PubChem (CID 10534645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).