C19H34N2 — CID 105346845
N-[[4-[2-(tert-butylamino)ethyl]phenyl]methyl]-N-ethyl-2-methylpropan-1-amine (PubChem CID 105346845) has the molecular formula C19H34N2 and a molecular weight of 290.50 g/mol. Its IUPAC name is N-[[4-[2-(tert-butylamino)ethyl]phenyl]methyl]-N-ethyl-2-methylpropan-1-amine.
| Compound Name | N-[[4-[2-(tert-butylamino)ethyl]phenyl]methyl]-N-ethyl-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 105346845 |
| Molecular Formula | C19H34N2 |
| Molecular Weight | 290.50 g/mol |
| Exact Mass | 290.27 |
| IUPAC Name | N-[[4-[2-(tert-butylamino)ethyl]phenyl]methyl]-N-ethyl-2-methylpropan-1-amine |
| SMILES | CCN(Cc1ccc(CCNC(C)(C)C)cc1)CC(C)C |
| InChI | InChI=1S/C19H34N2/c1-7-21(14-16(2)3)15-18-10-8-17(9-11-18)12-13-20-19(4,5)6/h8-11,16,20H,7,12-15H2,1-6H3 |
| InChIKey | XHWXCDGCFUAJPE-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.50 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |