About 5-methyl-1H-pyrazolo[1,5-a]pyrimidin-7-one
5-methyl-1H-pyrazolo[1,5-a]pyrimidin-7-one (PubChem CID 10534815) has the molecular formula C7H7N3O
and a molecular weight of 149.15 g/mol. Its IUPAC name is 5-methyl-1H-pyrazolo[1,5-a]pyrimidin-7-one.
Molecular Properties
| Compound Name | 5-methyl-1H-pyrazolo[1,5-a]pyrimidin-7-one |
| PubChem CID | 10534815 |
| Molecular Formula | C7H7N3O |
| Molecular Weight | 149.15 g/mol |
| Exact Mass | 149.06 |
| IUPAC Name | 5-methyl-1H-pyrazolo[1,5-a]pyrimidin-7-one |
| SMILES | Cc1cc(=O)n2[nH]ccc2n1 |
| InChI | InChI=1S/C7H7N3O/c1-5-4-7(11)10-6(9-5)2-3-8-10/h2-4,8H,1H3 |
| InChIKey | SYPDOBOILKZQJY-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.15 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-methyl-1H-pyrazolo[1,5-a]pyrimidin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-1H-pyrazolo[1,5-a]pyrimidin-7-one?
The IUPAC name of 5-methyl-1H-pyrazolo[1,5-a]pyrimidin-7-one (CID 10534815) is 5-methyl-1H-pyrazolo[1,5-a]pyrimidin-7-one.
What is the SMILES notation for 5-methyl-1H-pyrazolo[1,5-a]pyrimidin-7-one?
The canonical SMILES for 5-methyl-1H-pyrazolo[1,5-a]pyrimidin-7-one is Cc1cc(=O)n2[nH]ccc2n1.
What is the InChIKey of 5-methyl-1H-pyrazolo[1,5-a]pyrimidin-7-one?
The InChIKey is SYPDOBOILKZQJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3O/c1-5-4-7(11)10-6(9-5)2-3-8-10/h2-4,8H,1H3.
What are the key properties of 5-methyl-1H-pyrazolo[1,5-a]pyrimidin-7-one?
5-methyl-1H-pyrazolo[1,5-a]pyrimidin-7-one has a molecular weight of 149.15 g/mol, XLogP of 0.33, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-1H-pyrazolo[1,5-a]pyrimidin-7-one is sourced from PubChem (CID 10534815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).