About (2R,5S)-2,5-dimethyl-1-prop-2-enylpiperazine
(2R,5S)-2,5-dimethyl-1-prop-2-enylpiperazine (PubChem CID 10534891) has the molecular formula C9H18N2
and a molecular weight of 154.26 g/mol. Its IUPAC name is (2R,5S)-2,5-dimethyl-1-prop-2-enylpiperazine.
Molecular Properties
| Compound Name | (2R,5S)-2,5-dimethyl-1-prop-2-enylpiperazine |
| PubChem CID | 10534891 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | (2R,5S)-2,5-dimethyl-1-prop-2-enylpiperazine |
| SMILES | C=CCN1C[C@H](C)NC[C@H]1C |
| InChI | InChI=1S/C9H18N2/c1-4-5-11-7-8(2)10-6-9(11)3/h4,8-10H,1,5-7H2,2-3H3/t8-,9+/m0/s1 |
| InChIKey | VKUXNUOPPQWDMV-DTWKUNHWSA-N |
| XLogP | 0.85 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2R,5S)-2,5-dimethyl-1-prop-2-enylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,5S)-2,5-dimethyl-1-prop-2-enylpiperazine?
The IUPAC name of (2R,5S)-2,5-dimethyl-1-prop-2-enylpiperazine (CID 10534891) is (2R,5S)-2,5-dimethyl-1-prop-2-enylpiperazine.
What is the SMILES notation for (2R,5S)-2,5-dimethyl-1-prop-2-enylpiperazine?
The canonical SMILES for (2R,5S)-2,5-dimethyl-1-prop-2-enylpiperazine is C=CCN1C[C@H](C)NC[C@H]1C.
What is the InChIKey of (2R,5S)-2,5-dimethyl-1-prop-2-enylpiperazine?
The InChIKey is VKUXNUOPPQWDMV-DTWKUNHWSA-N. The full InChI is InChI=1S/C9H18N2/c1-4-5-11-7-8(2)10-6-9(11)3/h4,8-10H,1,5-7H2,2-3H3/t8-,9+/m0/s1.
What are the key properties of (2R,5S)-2,5-dimethyl-1-prop-2-enylpiperazine?
(2R,5S)-2,5-dimethyl-1-prop-2-enylpiperazine has a molecular weight of 154.26 g/mol, XLogP of 0.85, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,5S)-2,5-dimethyl-1-prop-2-enylpiperazine is sourced from PubChem (CID 10534891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).