C15H22F3NO — CID 105349058
2-methyl-N-[2-[4-(2,2,2-trifluoroethoxymethyl)phenyl]ethyl]propan-1-amine (PubChem CID 105349058) has the molecular formula C15H22F3NO and a molecular weight of 289.34 g/mol. Its IUPAC name is 2-methyl-N-[2-[4-(2,2,2-trifluoroethoxymethyl)phenyl]ethyl]propan-1-amine.
| Compound Name | 2-methyl-N-[2-[4-(2,2,2-trifluoroethoxymethyl)phenyl]ethyl]propan-1-amine |
|---|---|
| PubChem CID | 105349058 |
| Molecular Formula | C15H22F3NO |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | 2-methyl-N-[2-[4-(2,2,2-trifluoroethoxymethyl)phenyl]ethyl]propan-1-amine |
| SMILES | CC(C)CNCCc1ccc(COCC(F)(F)F)cc1 |
| InChI | InChI=1S/C15H22F3NO/c1-12(2)9-19-8-7-13-3-5-14(6-4-13)10-20-11-15(16,17)18/h3-6,12,19H,7-11H2,1-2H3 |
| InChIKey | PETNYMCWLYAPIC-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|