About (3-iodophenyl)-(2,3,4,6-tetrachlorophenyl)methanone
(3-iodophenyl)-(2,3,4,6-tetrachlorophenyl)methanone (PubChem CID 105349171) has the molecular formula C13H5Cl4IO
and a molecular weight of 445.90 g/mol. Its IUPAC name is (3-iodophenyl)-(2,3,4,6-tetrachlorophenyl)methanone.
Molecular Properties
| Compound Name | (3-iodophenyl)-(2,3,4,6-tetrachlorophenyl)methanone |
| PubChem CID | 105349171 |
| Molecular Formula | C13H5Cl4IO |
| Molecular Weight | 445.90 g/mol |
| Exact Mass | 443.81 |
| IUPAC Name | (3-iodophenyl)-(2,3,4,6-tetrachlorophenyl)methanone |
| SMILES | O=C(c1cccc(I)c1)c1c(Cl)cc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C13H5Cl4IO/c14-8-5-9(15)11(16)12(17)10(8)13(19)6-2-1-3-7(18)4-6/h1-5H |
| InChIKey | ILJZKRWRGNIZQK-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 445.90 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (3-iodophenyl)-(2,3,4,6-tetrachlorophenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-iodophenyl)-(2,3,4,6-tetrachlorophenyl)methanone?
The IUPAC name of (3-iodophenyl)-(2,3,4,6-tetrachlorophenyl)methanone (CID 105349171) is (3-iodophenyl)-(2,3,4,6-tetrachlorophenyl)methanone.
What is the SMILES notation for (3-iodophenyl)-(2,3,4,6-tetrachlorophenyl)methanone?
The canonical SMILES for (3-iodophenyl)-(2,3,4,6-tetrachlorophenyl)methanone is O=C(c1cccc(I)c1)c1c(Cl)cc(Cl)c(Cl)c1Cl.
What is the InChIKey of (3-iodophenyl)-(2,3,4,6-tetrachlorophenyl)methanone?
The InChIKey is ILJZKRWRGNIZQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H5Cl4IO/c14-8-5-9(15)11(16)12(17)10(8)13(19)6-2-1-3-7(18)4-6/h1-5H.
What are the key properties of (3-iodophenyl)-(2,3,4,6-tetrachlorophenyl)methanone?
(3-iodophenyl)-(2,3,4,6-tetrachlorophenyl)methanone has a molecular weight of 445.90 g/mol, XLogP of 6.14, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3-iodophenyl)-(2,3,4,6-tetrachlorophenyl)methanone is sourced from PubChem (CID 105349171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).