C14H12Cl4O3 — CID 105349533
4-methyl-2-(2,3,4,6-tetrachlorobenzoyl)cyclopentane-1-carboxylic acid (PubChem CID 105349533) has the molecular formula C14H12Cl4O3 and a molecular weight of 370.06 g/mol. Its IUPAC name is 4-methyl-2-(2,3,4,6-tetrachlorobenzoyl)cyclopentane-1-carboxylic acid.
| Compound Name | 4-methyl-2-(2,3,4,6-tetrachlorobenzoyl)cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 105349533 |
| Molecular Formula | C14H12Cl4O3 |
| Molecular Weight | 370.06 g/mol |
| Exact Mass | 367.95 |
| IUPAC Name | 4-methyl-2-(2,3,4,6-tetrachlorobenzoyl)cyclopentane-1-carboxylic acid |
| SMILES | CC1CC(C(=O)O)C(C(=O)c2c(Cl)cc(Cl)c(Cl)c2Cl)C1 |
| InChI | InChI=1S/C14H12Cl4O3/c1-5-2-6(7(3-5)14(20)21)13(19)10-8(15)4-9(16)11(17)12(10)18/h4-7H,2-3H2,1H3,(H,20,21) |
| InChIKey | CYDYJJTUPXSGRG-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.06 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|