C12H8Cl4N2 — CID 105349955
4-methyl-5-(2,3,4,6-tetrachlorophenyl)pyridin-2-amine (PubChem CID 105349955) has the molecular formula C12H8Cl4N2 and a molecular weight of 322.02 g/mol. Its IUPAC name is 4-methyl-5-(2,3,4,6-tetrachlorophenyl)pyridin-2-amine.
| Compound Name | 4-methyl-5-(2,3,4,6-tetrachlorophenyl)pyridin-2-amine |
|---|---|
| PubChem CID | 105349955 |
| Molecular Formula | C12H8Cl4N2 |
| Molecular Weight | 322.02 g/mol |
| Exact Mass | 319.94 |
| IUPAC Name | 4-methyl-5-(2,3,4,6-tetrachlorophenyl)pyridin-2-amine |
| SMILES | Cc1cc(N)ncc1-c1c(Cl)cc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C12H8Cl4N2/c1-5-2-9(17)18-4-6(5)10-7(13)3-8(14)11(15)12(10)16/h2-4H,1H3,(H2,17,18) |
| InChIKey | RHHIJYHYIRYICU-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.02 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|