About furo[3,2-b]pyridine-5-carboxylic acid
furo[3,2-b]pyridine-5-carboxylic acid (PubChem CID 10535000) has the molecular formula C8H5NO3
and a molecular weight of 163.13 g/mol. Its IUPAC name is furo[3,2-b]pyridine-5-carboxylic acid.
Molecular Properties
| Compound Name | furo[3,2-b]pyridine-5-carboxylic acid |
| PubChem CID | 10535000 |
| Molecular Formula | C8H5NO3 |
| Molecular Weight | 163.13 g/mol |
| Exact Mass | 163.03 |
| IUPAC Name | furo[3,2-b]pyridine-5-carboxylic acid |
| SMILES | O=C(O)c1ccc2occc2n1 |
| InChI | InChI=1S/C8H5NO3/c10-8(11)6-1-2-7-5(9-6)3-4-12-7/h1-4H,(H,10,11) |
| InChIKey | JFYLKLRQPTZVAW-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.13 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze furo[3,2-b]pyridine-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of furo[3,2-b]pyridine-5-carboxylic acid?
The IUPAC name of furo[3,2-b]pyridine-5-carboxylic acid (CID 10535000) is furo[3,2-b]pyridine-5-carboxylic acid.
What is the SMILES notation for furo[3,2-b]pyridine-5-carboxylic acid?
The canonical SMILES for furo[3,2-b]pyridine-5-carboxylic acid is O=C(O)c1ccc2occc2n1.
What is the InChIKey of furo[3,2-b]pyridine-5-carboxylic acid?
The InChIKey is JFYLKLRQPTZVAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5NO3/c10-8(11)6-1-2-7-5(9-6)3-4-12-7/h1-4H,(H,10,11).
What are the key properties of furo[3,2-b]pyridine-5-carboxylic acid?
furo[3,2-b]pyridine-5-carboxylic acid has a molecular weight of 163.13 g/mol, XLogP of 1.53, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for furo[3,2-b]pyridine-5-carboxylic acid is sourced from PubChem (CID 10535000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).