About (2R)-1,1-difluoro-6-methylhept-5-en-2-ol
(2R)-1,1-difluoro-6-methylhept-5-en-2-ol (PubChem CID 10535014) has the molecular formula C8H14F2O
and a molecular weight of 164.19 g/mol. Its IUPAC name is (2R)-1,1-difluoro-6-methylhept-5-en-2-ol.
Molecular Properties
| Compound Name | (2R)-1,1-difluoro-6-methylhept-5-en-2-ol |
| PubChem CID | 10535014 |
| Molecular Formula | C8H14F2O |
| Molecular Weight | 164.19 g/mol |
| Exact Mass | 164.10 |
| IUPAC Name | (2R)-1,1-difluoro-6-methylhept-5-en-2-ol |
| SMILES | CC(C)=CCC[C@@H](O)C(F)F |
| InChI | InChI=1S/C8H14F2O/c1-6(2)4-3-5-7(11)8(9)10/h4,7-8,11H,3,5H2,1-2H3/t7-/m1/s1 |
| InChIKey | UFQQOBWGPQETLL-SSDOTTSWSA-N |
| XLogP | 2.36 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.19 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2R)-1,1-difluoro-6-methylhept-5-en-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-1,1-difluoro-6-methylhept-5-en-2-ol?
The IUPAC name of (2R)-1,1-difluoro-6-methylhept-5-en-2-ol (CID 10535014) is (2R)-1,1-difluoro-6-methylhept-5-en-2-ol.
What is the SMILES notation for (2R)-1,1-difluoro-6-methylhept-5-en-2-ol?
The canonical SMILES for (2R)-1,1-difluoro-6-methylhept-5-en-2-ol is CC(C)=CCC[C@@H](O)C(F)F.
What is the InChIKey of (2R)-1,1-difluoro-6-methylhept-5-en-2-ol?
The InChIKey is UFQQOBWGPQETLL-SSDOTTSWSA-N. The full InChI is InChI=1S/C8H14F2O/c1-6(2)4-3-5-7(11)8(9)10/h4,7-8,11H,3,5H2,1-2H3/t7-/m1/s1.
What are the key properties of (2R)-1,1-difluoro-6-methylhept-5-en-2-ol?
(2R)-1,1-difluoro-6-methylhept-5-en-2-ol has a molecular weight of 164.19 g/mol, XLogP of 2.36, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-1,1-difluoro-6-methylhept-5-en-2-ol is sourced from PubChem (CID 10535014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).