C20H15ClN4O2 — CID 1053527
1-(3-chlorophenyl)-3-(furan-2-yl)-N-(pyridin-3-ylmethyl)pyrazole-5-carboxamide (PubChem CID 1053527) has the molecular formula C20H15ClN4O2 and a molecular weight of 378.82 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-(furan-2-yl)-N-(pyridin-3-ylmethyl)pyrazole-5-carboxamide.
| Compound Name | 1-(3-chlorophenyl)-3-(furan-2-yl)-N-(pyridin-3-ylmethyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 1053527 |
| Molecular Formula | C20H15ClN4O2 |
| Molecular Weight | 378.82 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | 1-(3-chlorophenyl)-3-(furan-2-yl)-N-(pyridin-3-ylmethyl)pyrazole-5-carboxamide |
| SMILES | O=C(NCc1cccnc1)c1cc(-c2ccco2)nn1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C20H15ClN4O2/c21-15-5-1-6-16(10-15)25-18(11-17(24-25)19-7-3-9-27-19)20(26)23-13-14-4-2-8-22-12-14/h1-12H,13H2,(H,23,26) |
| InChIKey | BBWYQJKMTUQJAO-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 72.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.82 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |