2-(1,4-dioxaspiro[4.4]nonan-3-ylmethylsulfanyl)butanoic acid

C12H20O4S — CID 105352975

IUPAC2-(1,4-dioxaspiro[4.4]nonan-3-ylmethylsulfanyl)butanoic acid
SMILESCCC(SCC1COC2(CCCC2)O1)C(=O)O
InChIInChI=1S/C12H20O4S/c1-2-10(11(13)14)17-8-9-7-15-12(16-9)5-3-4-6-12/h9-10H,2-8H2,1H3,(H,13,14)
InChIKeySULYVRRYTDMOKL-UHFFFAOYSA-N
MW260.35 g/mol
LogP2.27
Rot. Bonds5

About 2-(1,4-dioxaspiro[4.4]nonan-3-ylmethylsulfanyl)butanoic acid

2-(1,4-dioxaspiro[4.4]nonan-3-ylmethylsulfanyl)butanoic acid (PubChem CID 105352975) has the molecular formula C12H20O4S and a molecular weight of 260.35 g/mol. Its IUPAC name is 2-(1,4-dioxaspiro[4.4]nonan-3-ylmethylsulfanyl)butanoic acid.

Molecular Properties

Compound Name2-(1,4-dioxaspiro[4.4]nonan-3-ylmethylsulfanyl)butanoic acid
PubChem CID105352975
Molecular FormulaC12H20O4S
Molecular Weight260.35 g/mol
Exact Mass260.11
IUPAC Name2-(1,4-dioxaspiro[4.4]nonan-3-ylmethylsulfanyl)butanoic acid
SMILESCCC(SCC1COC2(CCCC2)O1)C(=O)O
InChIInChI=1S/C12H20O4S/c1-2-10(11(13)14)17-8-9-7-15-12(16-9)5-3-4-6-12/h9-10H,2-8H2,1H3,(H,13,14)
InChIKeySULYVRRYTDMOKL-UHFFFAOYSA-N
XLogP2.27
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500260.35
LogP ≤ 52.27
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-(1,4-dioxaspiro[4.4]nonan-3-ylmethylsulfanyl)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1,4-dioxaspiro[4.4]nonan-3-ylmethylsulfanyl)butanoic acid?
The IUPAC name of 2-(1,4-dioxaspiro[4.4]nonan-3-ylmethylsulfanyl)butanoic acid (CID 105352975) is 2-(1,4-dioxaspiro[4.4]nonan-3-ylmethylsulfanyl)butanoic acid.
What is the SMILES notation for 2-(1,4-dioxaspiro[4.4]nonan-3-ylmethylsulfanyl)butanoic acid?
The canonical SMILES for 2-(1,4-dioxaspiro[4.4]nonan-3-ylmethylsulfanyl)butanoic acid is CCC(SCC1COC2(CCCC2)O1)C(=O)O.
What is the InChIKey of 2-(1,4-dioxaspiro[4.4]nonan-3-ylmethylsulfanyl)butanoic acid?
The InChIKey is SULYVRRYTDMOKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O4S/c1-2-10(11(13)14)17-8-9-7-15-12(16-9)5-3-4-6-12/h9-10H,2-8H2,1H3,(H,13,14).
What are the key properties of 2-(1,4-dioxaspiro[4.4]nonan-3-ylmethylsulfanyl)butanoic acid?
2-(1,4-dioxaspiro[4.4]nonan-3-ylmethylsulfanyl)butanoic acid has a molecular weight of 260.35 g/mol, XLogP of 2.27, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,4-dioxaspiro[4.4]nonan-3-ylmethylsulfanyl)butanoic acid is sourced from PubChem (CID 105352975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).