C13H13ClO2S2 — CID 105352983
2-[(3-chloro-1-benzothiophen-2-yl)methylsulfanyl]butanoic acid (PubChem CID 105352983) has the molecular formula C13H13ClO2S2 and a molecular weight of 300.83 g/mol. Its IUPAC name is 2-[(3-chloro-1-benzothiophen-2-yl)methylsulfanyl]butanoic acid.
| Compound Name | 2-[(3-chloro-1-benzothiophen-2-yl)methylsulfanyl]butanoic acid |
|---|---|
| PubChem CID | 105352983 |
| Molecular Formula | C13H13ClO2S2 |
| Molecular Weight | 300.83 g/mol |
| Exact Mass | 300.00 |
| IUPAC Name | 2-[(3-chloro-1-benzothiophen-2-yl)methylsulfanyl]butanoic acid |
| SMILES | CCC(SCc1sc2ccccc2c1Cl)C(=O)O |
| InChI | InChI=1S/C13H13ClO2S2/c1-2-9(13(15)16)17-7-11-12(14)8-5-3-4-6-10(8)18-11/h3-6,9H,2,7H2,1H3,(H,15,16) |
| InChIKey | BQOUJLNKNMSQJC-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.83 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |