C11H21NO3S — CID 105353041
2-[1-(tert-butylamino)-1-oxopropan-2-yl]sulfanylbutanoic acid (PubChem CID 105353041) has the molecular formula C11H21NO3S and a molecular weight of 247.36 g/mol. Its IUPAC name is 2-[1-(tert-butylamino)-1-oxopropan-2-yl]sulfanylbutanoic acid.
| Compound Name | 2-[1-(tert-butylamino)-1-oxopropan-2-yl]sulfanylbutanoic acid |
|---|---|
| PubChem CID | 105353041 |
| Molecular Formula | C11H21NO3S |
| Molecular Weight | 247.36 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | 2-[1-(tert-butylamino)-1-oxopropan-2-yl]sulfanylbutanoic acid |
| SMILES | CCC(SC(C)C(=O)NC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C11H21NO3S/c1-6-8(10(14)15)16-7(2)9(13)12-11(3,4)5/h7-8H,6H2,1-5H3,(H,12,13)(H,14,15) |
| InChIKey | WYFHJCAWAINPNO-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.36 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |