About (2S,3S)-3-ethenyl-2-methyl-3-prop-2-enoxy-2,6-dihydropyran
(2S,3S)-3-ethenyl-2-methyl-3-prop-2-enoxy-2,6-dihydropyran (PubChem CID 10535383) has the molecular formula C11H16O2
and a molecular weight of 180.25 g/mol. Its IUPAC name is (2S,3S)-3-ethenyl-2-methyl-3-prop-2-enoxy-2,6-dihydropyran.
Molecular Properties
| Compound Name | (2S,3S)-3-ethenyl-2-methyl-3-prop-2-enoxy-2,6-dihydropyran |
| PubChem CID | 10535383 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | (2S,3S)-3-ethenyl-2-methyl-3-prop-2-enoxy-2,6-dihydropyran |
| SMILES | C=CCO[C@@]1(C=C)C=CCO[C@H]1C |
| InChI | InChI=1S/C11H16O2/c1-4-8-13-11(5-2)7-6-9-12-10(11)3/h4-7,10H,1-2,8-9H2,3H3/t10-,11-/m0/s1 |
| InChIKey | FDQQGZZNHJSFHP-QWRGUYRKSA-N |
| XLogP | 2.09 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2S,3S)-3-ethenyl-2-methyl-3-prop-2-enoxy-2,6-dihydropyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,3S)-3-ethenyl-2-methyl-3-prop-2-enoxy-2,6-dihydropyran?
The IUPAC name of (2S,3S)-3-ethenyl-2-methyl-3-prop-2-enoxy-2,6-dihydropyran (CID 10535383) is (2S,3S)-3-ethenyl-2-methyl-3-prop-2-enoxy-2,6-dihydropyran.
What is the SMILES notation for (2S,3S)-3-ethenyl-2-methyl-3-prop-2-enoxy-2,6-dihydropyran?
The canonical SMILES for (2S,3S)-3-ethenyl-2-methyl-3-prop-2-enoxy-2,6-dihydropyran is C=CCO[C@@]1(C=C)C=CCO[C@H]1C.
What is the InChIKey of (2S,3S)-3-ethenyl-2-methyl-3-prop-2-enoxy-2,6-dihydropyran?
The InChIKey is FDQQGZZNHJSFHP-QWRGUYRKSA-N. The full InChI is InChI=1S/C11H16O2/c1-4-8-13-11(5-2)7-6-9-12-10(11)3/h4-7,10H,1-2,8-9H2,3H3/t10-,11-/m0/s1.
What are the key properties of (2S,3S)-3-ethenyl-2-methyl-3-prop-2-enoxy-2,6-dihydropyran?
(2S,3S)-3-ethenyl-2-methyl-3-prop-2-enoxy-2,6-dihydropyran has a molecular weight of 180.25 g/mol, XLogP of 2.09, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3S)-3-ethenyl-2-methyl-3-prop-2-enoxy-2,6-dihydropyran is sourced from PubChem (CID 10535383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).