About N,N-dicyclopentylformamide
N,N-dicyclopentylformamide (PubChem CID 10535407) has the molecular formula C11H19NO
and a molecular weight of 181.28 g/mol. Its IUPAC name is N,N-dicyclopentylformamide.
Molecular Properties
| Compound Name | N,N-dicyclopentylformamide |
| PubChem CID | 10535407 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | N,N-dicyclopentylformamide |
| SMILES | O=CN(C1CCCC1)C1CCCC1 |
| InChI | InChI=1S/C11H19NO/c13-9-12(10-5-1-2-6-10)11-7-3-4-8-11/h9-11H,1-8H2 |
| InChIKey | POFVZZUUHSLXHI-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N,N-dicyclopentylformamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dicyclopentylformamide?
The IUPAC name of N,N-dicyclopentylformamide (CID 10535407) is N,N-dicyclopentylformamide.
What is the SMILES notation for N,N-dicyclopentylformamide?
The canonical SMILES for N,N-dicyclopentylformamide is O=CN(C1CCCC1)C1CCCC1.
What is the InChIKey of N,N-dicyclopentylformamide?
The InChIKey is POFVZZUUHSLXHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO/c13-9-12(10-5-1-2-6-10)11-7-3-4-8-11/h9-11H,1-8H2.
What are the key properties of N,N-dicyclopentylformamide?
N,N-dicyclopentylformamide has a molecular weight of 181.28 g/mol, XLogP of 2.33, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dicyclopentylformamide is sourced from PubChem (CID 10535407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).