C10H14O3 — CID 10535429
(2E,4E)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]penta-2,4-dienal (PubChem CID 10535429) has the molecular formula C10H14O3 and a molecular weight of 182.22 g/mol. Its IUPAC name is (2E,4E)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]penta-2,4-dienal.
| Compound Name | (2E,4E)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]penta-2,4-dienal |
|---|---|
| PubChem CID | 10535429 |
| Molecular Formula | C10H14O3 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | (2E,4E)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]penta-2,4-dienal |
| SMILES | CC1(C)OC[C@H](/C=C/C=C/C=O)O1 |
| InChI | InChI=1S/C10H14O3/c1-10(2)12-8-9(13-10)6-4-3-5-7-11/h3-7,9H,8H2,1-2H3/b5-3+,6-4+/t9-/m0/s1 |
| InChIKey | FTCUEYHMLBJXFU-HBBLVLSZSA-N |
| XLogP | 1.45 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|