C11H18O2 — CID 10535439
1-[(2S,3R)-3-but-3-enyl-3-methyloxiran-2-yl]-2-methylpropan-1-one (PubChem CID 10535439) has the molecular formula C11H18O2 and a molecular weight of 182.26 g/mol. Its IUPAC name is 1-[(2S,3R)-3-but-3-enyl-3-methyloxiran-2-yl]-2-methylpropan-1-one.
| Compound Name | 1-[(2S,3R)-3-but-3-enyl-3-methyloxiran-2-yl]-2-methylpropan-1-one |
|---|---|
| PubChem CID | 10535439 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | 1-[(2S,3R)-3-but-3-enyl-3-methyloxiran-2-yl]-2-methylpropan-1-one |
| SMILES | C=CCC[C@@]1(C)O[C@@H]1C(=O)C(C)C |
| InChI | InChI=1S/C11H18O2/c1-5-6-7-11(4)10(13-11)9(12)8(2)3/h5,8,10H,1,6-7H2,2-4H3/t10-,11-/m1/s1 |
| InChIKey | MRCWKFFPSZRFSF-GHMZBOCLSA-N |
| XLogP | 2.34 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|