C14H16O4S2 — CID 105354677
2-(1-benzothiophen-3-ylmethylsulfonyl)-3-methylbutanoic acid (PubChem CID 105354677) has the molecular formula C14H16O4S2 and a molecular weight of 312.41 g/mol. Its IUPAC name is 2-(1-benzothiophen-3-ylmethylsulfonyl)-3-methylbutanoic acid.
| Compound Name | 2-(1-benzothiophen-3-ylmethylsulfonyl)-3-methylbutanoic acid |
|---|---|
| PubChem CID | 105354677 |
| Molecular Formula | C14H16O4S2 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | 2-(1-benzothiophen-3-ylmethylsulfonyl)-3-methylbutanoic acid |
| SMILES | CC(C)C(C(=O)O)S(=O)(=O)Cc1csc2ccccc12 |
| InChI | InChI=1S/C14H16O4S2/c1-9(2)13(14(15)16)20(17,18)8-10-7-19-12-6-4-3-5-11(10)12/h3-7,9,13H,8H2,1-2H3,(H,15,16) |
| InChIKey | MDTHBMLRSWMJAF-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |