C12H21NO6S — CID 105354719
3-methyl-2-[2-(oxan-4-ylamino)-2-oxoethyl]sulfonylbutanoic acid (PubChem CID 105354719) has the molecular formula C12H21NO6S and a molecular weight of 307.37 g/mol. Its IUPAC name is 3-methyl-2-[2-(oxan-4-ylamino)-2-oxoethyl]sulfonylbutanoic acid.
| Compound Name | 3-methyl-2-[2-(oxan-4-ylamino)-2-oxoethyl]sulfonylbutanoic acid |
|---|---|
| PubChem CID | 105354719 |
| Molecular Formula | C12H21NO6S |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | 3-methyl-2-[2-(oxan-4-ylamino)-2-oxoethyl]sulfonylbutanoic acid |
| SMILES | CC(C)C(C(=O)O)S(=O)(=O)CC(=O)NC1CCOCC1 |
| InChI | InChI=1S/C12H21NO6S/c1-8(2)11(12(15)16)20(17,18)7-10(14)13-9-3-5-19-6-4-9/h8-9,11H,3-7H2,1-2H3,(H,13,14)(H,15,16) |
| InChIKey | PREHGKWQYDZRQF-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |