C13H25NO5S — CID 105354724
3-methyl-2-[(4-propan-2-ylmorpholin-2-yl)methylsulfonyl]butanoic acid (PubChem CID 105354724) has the molecular formula C13H25NO5S and a molecular weight of 307.41 g/mol. Its IUPAC name is 3-methyl-2-[(4-propan-2-ylmorpholin-2-yl)methylsulfonyl]butanoic acid.
| Compound Name | 3-methyl-2-[(4-propan-2-ylmorpholin-2-yl)methylsulfonyl]butanoic acid |
|---|---|
| PubChem CID | 105354724 |
| Molecular Formula | C13H25NO5S |
| Molecular Weight | 307.41 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | 3-methyl-2-[(4-propan-2-ylmorpholin-2-yl)methylsulfonyl]butanoic acid |
| SMILES | CC(C)C(C(=O)O)S(=O)(=O)CC1CN(C(C)C)CCO1 |
| InChI | InChI=1S/C13H25NO5S/c1-9(2)12(13(15)16)20(17,18)8-11-7-14(10(3)4)5-6-19-11/h9-12H,5-8H2,1-4H3,(H,15,16) |
| InChIKey | NQMORTHHNDNVER-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.41 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |