C12H14N2O2S — CID 105355130
2-[(3-cyano-6-methyl-2-pyridinyl)sulfanyl]-3-methylbutanoic acid (PubChem CID 105355130) has the molecular formula C12H14N2O2S and a molecular weight of 250.32 g/mol. Its IUPAC name is 2-[(3-cyano-6-methyl-2-pyridinyl)sulfanyl]-3-methylbutanoic acid.
| Compound Name | 2-[(3-cyano-6-methyl-2-pyridinyl)sulfanyl]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 105355130 |
| Molecular Formula | C12H14N2O2S |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | 2-[(3-cyano-6-methyl-2-pyridinyl)sulfanyl]-3-methylbutanoic acid |
| SMILES | Cc1ccc(C#N)c(SC(C(=O)O)C(C)C)n1 |
| InChI | InChI=1S/C12H14N2O2S/c1-7(2)10(12(15)16)17-11-9(6-13)5-4-8(3)14-11/h4-5,7,10H,1-3H3,(H,15,16) |
| InChIKey | RAWUSNHHXLKBMB-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 73.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |