C9H11IN2O3S — CID 105355350
2-[(5-iodo-6-oxo-1H-pyrimidin-4-yl)sulfanyl]-3-methylbutanoic acid (PubChem CID 105355350) has the molecular formula C9H11IN2O3S and a molecular weight of 354.17 g/mol. Its IUPAC name is 2-[(5-iodo-6-oxo-1H-pyrimidin-4-yl)sulfanyl]-3-methylbutanoic acid.
| Compound Name | 2-[(5-iodo-6-oxo-1H-pyrimidin-4-yl)sulfanyl]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 105355350 |
| Molecular Formula | C9H11IN2O3S |
| Molecular Weight | 354.17 g/mol |
| Exact Mass | 353.95 |
| IUPAC Name | 2-[(5-iodo-6-oxo-1H-pyrimidin-4-yl)sulfanyl]-3-methylbutanoic acid |
| SMILES | CC(C)C(Sc1nc[nH]c(=O)c1I)C(=O)O |
| InChI | InChI=1S/C9H11IN2O3S/c1-4(2)6(9(14)15)16-8-5(10)7(13)11-3-12-8/h3-4,6H,1-2H3,(H,14,15)(H,11,12,13) |
| InChIKey | YJMGEOSRHLIFMY-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 83.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.17 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|