C12H15FO3S — CID 105355650
2-[(4-fluoro-2-methylphenyl)methylsulfinyl]butanoic acid (PubChem CID 105355650) has the molecular formula C12H15FO3S and a molecular weight of 258.31 g/mol. Its IUPAC name is 2-[(4-fluoro-2-methylphenyl)methylsulfinyl]butanoic acid.
| Compound Name | 2-[(4-fluoro-2-methylphenyl)methylsulfinyl]butanoic acid |
|---|---|
| PubChem CID | 105355650 |
| Molecular Formula | C12H15FO3S |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | 2-[(4-fluoro-2-methylphenyl)methylsulfinyl]butanoic acid |
| SMILES | CCC(C(=O)O)S(=O)Cc1ccc(F)cc1C |
| InChI | InChI=1S/C12H15FO3S/c1-3-11(12(14)15)17(16)7-9-4-5-10(13)6-8(9)2/h4-6,11H,3,7H2,1-2H3,(H,14,15) |
| InChIKey | ZGSGKIHPWMKWAK-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |