C9H13FO3 — CID 10535605
[(1S,3R,5S,6S)-5-fluoro-6-methyl-7-oxabicyclo[4.1.0]heptan-3-yl] acetate (PubChem CID 10535605) has the molecular formula C9H13FO3 and a molecular weight of 188.20 g/mol. Its IUPAC name is [(1S,3R,5S,6S)-5-fluoro-6-methyl-7-oxabicyclo[4.1.0]heptan-3-yl] acetate.
| Compound Name | [(1S,3R,5S,6S)-5-fluoro-6-methyl-7-oxabicyclo[4.1.0]heptan-3-yl] acetate |
|---|---|
| PubChem CID | 10535605 |
| Molecular Formula | C9H13FO3 |
| Molecular Weight | 188.20 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | [(1S,3R,5S,6S)-5-fluoro-6-methyl-7-oxabicyclo[4.1.0]heptan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C[C@@H]2O[C@]2(C)[C@@H](F)C1 |
| InChI | InChI=1S/C9H13FO3/c1-5(11)12-6-3-7(10)9(2)8(4-6)13-9/h6-8H,3-4H2,1-2H3/t6-,7-,8-,9+/m0/s1 |
| InChIKey | VXFALSJQMNIKSN-XSPKLOCKSA-N |
| XLogP | 1.21 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.20 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|