About 2-ethyl-5,7-difluoro-4H-1,4-benzothiazin-3-one
2-ethyl-5,7-difluoro-4H-1,4-benzothiazin-3-one (PubChem CID 105356058) has the molecular formula C10H9F2NOS
and a molecular weight of 229.25 g/mol. Its IUPAC name is 2-ethyl-5,7-difluoro-4H-1,4-benzothiazin-3-one.
Molecular Properties
| Compound Name | 2-ethyl-5,7-difluoro-4H-1,4-benzothiazin-3-one |
| PubChem CID | 105356058 |
| Molecular Formula | C10H9F2NOS |
| Molecular Weight | 229.25 g/mol |
| Exact Mass | 229.04 |
| IUPAC Name | 2-ethyl-5,7-difluoro-4H-1,4-benzothiazin-3-one |
| SMILES | CCC1Sc2cc(F)cc(F)c2NC1=O |
| InChI | InChI=1S/C10H9F2NOS/c1-2-7-10(14)13-9-6(12)3-5(11)4-8(9)15-7/h3-4,7H,2H2,1H3,(H,13,14) |
| InChIKey | DHINSICUAZWLDK-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.25 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-ethyl-5,7-difluoro-4H-1,4-benzothiazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-5,7-difluoro-4H-1,4-benzothiazin-3-one?
The IUPAC name of 2-ethyl-5,7-difluoro-4H-1,4-benzothiazin-3-one (CID 105356058) is 2-ethyl-5,7-difluoro-4H-1,4-benzothiazin-3-one.
What is the SMILES notation for 2-ethyl-5,7-difluoro-4H-1,4-benzothiazin-3-one?
The canonical SMILES for 2-ethyl-5,7-difluoro-4H-1,4-benzothiazin-3-one is CCC1Sc2cc(F)cc(F)c2NC1=O.
What is the InChIKey of 2-ethyl-5,7-difluoro-4H-1,4-benzothiazin-3-one?
The InChIKey is DHINSICUAZWLDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9F2NOS/c1-2-7-10(14)13-9-6(12)3-5(11)4-8(9)15-7/h3-4,7H,2H2,1H3,(H,13,14).
What are the key properties of 2-ethyl-5,7-difluoro-4H-1,4-benzothiazin-3-one?
2-ethyl-5,7-difluoro-4H-1,4-benzothiazin-3-one has a molecular weight of 229.25 g/mol, XLogP of 2.79, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-5,7-difluoro-4H-1,4-benzothiazin-3-one is sourced from PubChem (CID 105356058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).