About (4R)-N-tert-butyl-1,3-thiazolidine-4-carboxamide
(4R)-N-tert-butyl-1,3-thiazolidine-4-carboxamide (PubChem CID 10535636) has the molecular formula C8H16N2OS
and a molecular weight of 188.30 g/mol. Its IUPAC name is (4R)-N-tert-butyl-1,3-thiazolidine-4-carboxamide.
Molecular Properties
| Compound Name | (4R)-N-tert-butyl-1,3-thiazolidine-4-carboxamide |
| PubChem CID | 10535636 |
| Molecular Formula | C8H16N2OS |
| Molecular Weight | 188.30 g/mol |
| Exact Mass | 188.10 |
| IUPAC Name | (4R)-N-tert-butyl-1,3-thiazolidine-4-carboxamide |
| SMILES | CC(C)(C)NC(=O)[C@@H]1CSCN1 |
| InChI | InChI=1S/C8H16N2OS/c1-8(2,3)10-7(11)6-4-12-5-9-6/h6,9H,4-5H2,1-3H3,(H,10,11)/t6-/m0/s1 |
| InChIKey | CAFXTIBLUGDWNC-LURJTMIESA-N |
| XLogP | 0.56 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.30 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4R)-N-tert-butyl-1,3-thiazolidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-N-tert-butyl-1,3-thiazolidine-4-carboxamide?
The IUPAC name of (4R)-N-tert-butyl-1,3-thiazolidine-4-carboxamide (CID 10535636) is (4R)-N-tert-butyl-1,3-thiazolidine-4-carboxamide.
What is the SMILES notation for (4R)-N-tert-butyl-1,3-thiazolidine-4-carboxamide?
The canonical SMILES for (4R)-N-tert-butyl-1,3-thiazolidine-4-carboxamide is CC(C)(C)NC(=O)[C@@H]1CSCN1.
What is the InChIKey of (4R)-N-tert-butyl-1,3-thiazolidine-4-carboxamide?
The InChIKey is CAFXTIBLUGDWNC-LURJTMIESA-N. The full InChI is InChI=1S/C8H16N2OS/c1-8(2,3)10-7(11)6-4-12-5-9-6/h6,9H,4-5H2,1-3H3,(H,10,11)/t6-/m0/s1.
What are the key properties of (4R)-N-tert-butyl-1,3-thiazolidine-4-carboxamide?
(4R)-N-tert-butyl-1,3-thiazolidine-4-carboxamide has a molecular weight of 188.30 g/mol, XLogP of 0.56, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-N-tert-butyl-1,3-thiazolidine-4-carboxamide is sourced from PubChem (CID 10535636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).