C12H15ClOS — CID 105356551
8-chloro-3-propan-2-yl-3,4-dihydro-1H-isothiochromen-4-ol (PubChem CID 105356551) has the molecular formula C12H15ClOS and a molecular weight of 242.77 g/mol. Its IUPAC name is 8-chloro-3-propan-2-yl-3,4-dihydro-1H-isothiochromen-4-ol.
| Compound Name | 8-chloro-3-propan-2-yl-3,4-dihydro-1H-isothiochromen-4-ol |
|---|---|
| PubChem CID | 105356551 |
| Molecular Formula | C12H15ClOS |
| Molecular Weight | 242.77 g/mol |
| Exact Mass | 242.05 |
| IUPAC Name | 8-chloro-3-propan-2-yl-3,4-dihydro-1H-isothiochromen-4-ol |
| SMILES | CC(C)C1SCc2c(Cl)cccc2C1O |
| InChI | InChI=1S/C12H15ClOS/c1-7(2)12-11(14)8-4-3-5-10(13)9(8)6-15-12/h3-5,7,11-12,14H,6H2,1-2H3 |
| InChIKey | CTSPNMZMHILZTJ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.77 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |