C11H16N4O3S — CID 105357170
3-ethyl-5-methyl-11,11-dioxo-11λ6-thia-1,3,4,7-tetrazatricyclo[7.4.0.02,6]trideca-2(6),4-dien-8-one (PubChem CID 105357170) has the molecular formula C11H16N4O3S and a molecular weight of 284.34 g/mol. Its IUPAC name is 3-ethyl-5-methyl-11,11-dioxo-11λ6-thia-1,3,4,7-tetrazatricyclo[7.4.0.02,6]trideca-2(6),4-dien-8-one.
| Compound Name | 3-ethyl-5-methyl-11,11-dioxo-11λ6-thia-1,3,4,7-tetrazatricyclo[7.4.0.02,6]trideca-2(6),4-dien-8-one |
|---|---|
| PubChem CID | 105357170 |
| Molecular Formula | C11H16N4O3S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | 3-ethyl-5-methyl-11,11-dioxo-11λ6-thia-1,3,4,7-tetrazatricyclo[7.4.0.02,6]trideca-2(6),4-dien-8-one |
| SMILES | CCn1nc(C)c2c1N1CCS(=O)(=O)CC1C(=O)N2 |
| InChI | InChI=1S/C11H16N4O3S/c1-3-15-11-9(7(2)13-15)12-10(16)8-6-19(17,18)5-4-14(8)11/h8H,3-6H2,1-2H3,(H,12,16) |
| InChIKey | MNNCTGKYPAKXCS-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |