About 8-fluoro-3-methyl-1-oxo-3,5-dihydro-2H-1λ4,5-benzothiazepin-4-one
8-fluoro-3-methyl-1-oxo-3,5-dihydro-2H-1λ4,5-benzothiazepin-4-one (PubChem CID 105357177) has the molecular formula C10H10FNO2S
and a molecular weight of 227.26 g/mol. Its IUPAC name is 8-fluoro-3-methyl-1-oxo-3,5-dihydro-2H-1λ4,5-benzothiazepin-4-one.
Molecular Properties
| Compound Name | 8-fluoro-3-methyl-1-oxo-3,5-dihydro-2H-1λ4,5-benzothiazepin-4-one |
| PubChem CID | 105357177 |
| Molecular Formula | C10H10FNO2S |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.04 |
| IUPAC Name | 8-fluoro-3-methyl-1-oxo-3,5-dihydro-2H-1λ4,5-benzothiazepin-4-one |
| SMILES | CC1CS(=O)c2cc(F)ccc2NC1=O |
| InChI | InChI=1S/C10H10FNO2S/c1-6-5-15(14)9-4-7(11)2-3-8(9)12-10(6)13/h2-4,6H,5H2,1H3,(H,12,13) |
| InChIKey | VUNTVBLDBNPEEH-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-fluoro-3-methyl-1-oxo-3,5-dihydro-2H-1λ4,5-benzothiazepin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-fluoro-3-methyl-1-oxo-3,5-dihydro-2H-1λ4,5-benzothiazepin-4-one?
The IUPAC name of 8-fluoro-3-methyl-1-oxo-3,5-dihydro-2H-1λ4,5-benzothiazepin-4-one (CID 105357177) is 8-fluoro-3-methyl-1-oxo-3,5-dihydro-2H-1λ4,5-benzothiazepin-4-one.
What is the SMILES notation for 8-fluoro-3-methyl-1-oxo-3,5-dihydro-2H-1λ4,5-benzothiazepin-4-one?
The canonical SMILES for 8-fluoro-3-methyl-1-oxo-3,5-dihydro-2H-1λ4,5-benzothiazepin-4-one is CC1CS(=O)c2cc(F)ccc2NC1=O.
What is the InChIKey of 8-fluoro-3-methyl-1-oxo-3,5-dihydro-2H-1λ4,5-benzothiazepin-4-one?
The InChIKey is VUNTVBLDBNPEEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10FNO2S/c1-6-5-15(14)9-4-7(11)2-3-8(9)12-10(6)13/h2-4,6H,5H2,1H3,(H,12,13).
What are the key properties of 8-fluoro-3-methyl-1-oxo-3,5-dihydro-2H-1λ4,5-benzothiazepin-4-one?
8-fluoro-3-methyl-1-oxo-3,5-dihydro-2H-1λ4,5-benzothiazepin-4-one has a molecular weight of 227.26 g/mol, XLogP of 1.52, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-fluoro-3-methyl-1-oxo-3,5-dihydro-2H-1λ4,5-benzothiazepin-4-one is sourced from PubChem (CID 105357177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).