About 7-bromo-3-methyl-1-oxo-3,5-dihydro-2H-1λ4,5-benzothiazepin-4-one
7-bromo-3-methyl-1-oxo-3,5-dihydro-2H-1λ4,5-benzothiazepin-4-one (PubChem CID 105357212) has the molecular formula C10H10BrNO2S
and a molecular weight of 288.17 g/mol. Its IUPAC name is 7-bromo-3-methyl-1-oxo-3,5-dihydro-2H-1λ4,5-benzothiazepin-4-one.
Molecular Properties
| Compound Name | 7-bromo-3-methyl-1-oxo-3,5-dihydro-2H-1λ4,5-benzothiazepin-4-one |
| PubChem CID | 105357212 |
| Molecular Formula | C10H10BrNO2S |
| Molecular Weight | 288.17 g/mol |
| Exact Mass | 286.96 |
| IUPAC Name | 7-bromo-3-methyl-1-oxo-3,5-dihydro-2H-1λ4,5-benzothiazepin-4-one |
| SMILES | CC1CS(=O)c2ccc(Br)cc2NC1=O |
| InChI | InChI=1S/C10H10BrNO2S/c1-6-5-15(14)9-3-2-7(11)4-8(9)12-10(6)13/h2-4,6H,5H2,1H3,(H,12,13) |
| InChIKey | AZFMCTAHFRPCKK-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.17 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-bromo-3-methyl-1-oxo-3,5-dihydro-2H-1λ4,5-benzothiazepin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-3-methyl-1-oxo-3,5-dihydro-2H-1λ4,5-benzothiazepin-4-one?
The IUPAC name of 7-bromo-3-methyl-1-oxo-3,5-dihydro-2H-1λ4,5-benzothiazepin-4-one (CID 105357212) is 7-bromo-3-methyl-1-oxo-3,5-dihydro-2H-1λ4,5-benzothiazepin-4-one.
What is the SMILES notation for 7-bromo-3-methyl-1-oxo-3,5-dihydro-2H-1λ4,5-benzothiazepin-4-one?
The canonical SMILES for 7-bromo-3-methyl-1-oxo-3,5-dihydro-2H-1λ4,5-benzothiazepin-4-one is CC1CS(=O)c2ccc(Br)cc2NC1=O.
What is the InChIKey of 7-bromo-3-methyl-1-oxo-3,5-dihydro-2H-1λ4,5-benzothiazepin-4-one?
The InChIKey is AZFMCTAHFRPCKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10BrNO2S/c1-6-5-15(14)9-3-2-7(11)4-8(9)12-10(6)13/h2-4,6H,5H2,1H3,(H,12,13).
What are the key properties of 7-bromo-3-methyl-1-oxo-3,5-dihydro-2H-1λ4,5-benzothiazepin-4-one?
7-bromo-3-methyl-1-oxo-3,5-dihydro-2H-1λ4,5-benzothiazepin-4-one has a molecular weight of 288.17 g/mol, XLogP of 2.14, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-3-methyl-1-oxo-3,5-dihydro-2H-1λ4,5-benzothiazepin-4-one is sourced from PubChem (CID 105357212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).