C12H14F2N2O2S — CID 105357433
8,10-difluoro-2,4,4a,5,6,7-hexahydro-1H-[1,4]thiazino[4,3-a][1,5]benzodiazepine 3,3-dioxide (PubChem CID 105357433) has the molecular formula C12H14F2N2O2S and a molecular weight of 288.32 g/mol. Its IUPAC name is 8,10-difluoro-2,4,4a,5,6,7-hexahydro-1H-[1,4]thiazino[4,3-a][1,5]benzodiazepine 3,3-dioxide.
| Compound Name | 8,10-difluoro-2,4,4a,5,6,7-hexahydro-1H-[1,4]thiazino[4,3-a][1,5]benzodiazepine 3,3-dioxide |
|---|---|
| PubChem CID | 105357433 |
| Molecular Formula | C12H14F2N2O2S |
| Molecular Weight | 288.32 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | 8,10-difluoro-2,4,4a,5,6,7-hexahydro-1H-[1,4]thiazino[4,3-a][1,5]benzodiazepine 3,3-dioxide |
| SMILES | O=S1(=O)CCN2c3cc(F)cc(F)c3NCCC2C1 |
| InChI | InChI=1S/C12H14F2N2O2S/c13-8-5-10(14)12-11(6-8)16-3-4-19(17,18)7-9(16)1-2-15-12/h5-6,9,15H,1-4,7H2 |
| InChIKey | ZEOODBSGAWRIIJ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.32 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |