About methyl 2-(1,3-dithian-2-yl)acetate
methyl 2-(1,3-dithian-2-yl)acetate (PubChem CID 10535770) has the molecular formula C7H12O2S2
and a molecular weight of 192.30 g/mol. Its IUPAC name is methyl 2-(1,3-dithian-2-yl)acetate.
Molecular Properties
| Compound Name | methyl 2-(1,3-dithian-2-yl)acetate |
| PubChem CID | 10535770 |
| Molecular Formula | C7H12O2S2 |
| Molecular Weight | 192.30 g/mol |
| Exact Mass | 192.03 |
| IUPAC Name | methyl 2-(1,3-dithian-2-yl)acetate |
| SMILES | COC(=O)CC1SCCCS1 |
| InChI | InChI=1S/C7H12O2S2/c1-9-6(8)5-7-10-3-2-4-11-7/h7H,2-5H2,1H3 |
| InChIKey | YBOPCUINJDFIOQ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.30 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2-(1,3-dithian-2-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(1,3-dithian-2-yl)acetate?
The IUPAC name of methyl 2-(1,3-dithian-2-yl)acetate (CID 10535770) is methyl 2-(1,3-dithian-2-yl)acetate.
What is the SMILES notation for methyl 2-(1,3-dithian-2-yl)acetate?
The canonical SMILES for methyl 2-(1,3-dithian-2-yl)acetate is COC(=O)CC1SCCCS1.
What is the InChIKey of methyl 2-(1,3-dithian-2-yl)acetate?
The InChIKey is YBOPCUINJDFIOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O2S2/c1-9-6(8)5-7-10-3-2-4-11-7/h7H,2-5H2,1H3.
What are the key properties of methyl 2-(1,3-dithian-2-yl)acetate?
methyl 2-(1,3-dithian-2-yl)acetate has a molecular weight of 192.30 g/mol, XLogP of 1.75, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(1,3-dithian-2-yl)acetate is sourced from PubChem (CID 10535770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).