About (NE)-N-[3-(2,6,6-trimethylcyclohex-2-en-1-yl)propylidene]hydroxylamine
(NE)-N-[3-(2,6,6-trimethylcyclohex-2-en-1-yl)propylidene]hydroxylamine (PubChem CID 10535856) has the molecular formula C12H21NO
and a molecular weight of 195.31 g/mol. Its IUPAC name is (NE)-N-[3-(2,6,6-trimethylcyclohex-2-en-1-yl)propylidene]hydroxylamine.
Molecular Properties
| Compound Name | (NE)-N-[3-(2,6,6-trimethylcyclohex-2-en-1-yl)propylidene]hydroxylamine |
| PubChem CID | 10535856 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | (NE)-N-[3-(2,6,6-trimethylcyclohex-2-en-1-yl)propylidene]hydroxylamine |
| SMILES | CC1=CCCC(C)(C)C1CC/C=N/O |
| InChI | InChI=1S/C12H21NO/c1-10-6-4-8-12(2,3)11(10)7-5-9-13-14/h6,9,11,14H,4-5,7-8H2,1-3H3/b13-9+ |
| InChIKey | POJYCXFZAZMWCS-UKTHLTGXSA-N |
| XLogP | 3.61 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (NE)-N-[3-(2,6,6-trimethylcyclohex-2-en-1-yl)propylidene]hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (NE)-N-[3-(2,6,6-trimethylcyclohex-2-en-1-yl)propylidene]hydroxylamine?
The IUPAC name of (NE)-N-[3-(2,6,6-trimethylcyclohex-2-en-1-yl)propylidene]hydroxylamine (CID 10535856) is (NE)-N-[3-(2,6,6-trimethylcyclohex-2-en-1-yl)propylidene]hydroxylamine.
What is the SMILES notation for (NE)-N-[3-(2,6,6-trimethylcyclohex-2-en-1-yl)propylidene]hydroxylamine?
The canonical SMILES for (NE)-N-[3-(2,6,6-trimethylcyclohex-2-en-1-yl)propylidene]hydroxylamine is CC1=CCCC(C)(C)C1CC/C=N/O.
What is the InChIKey of (NE)-N-[3-(2,6,6-trimethylcyclohex-2-en-1-yl)propylidene]hydroxylamine?
The InChIKey is POJYCXFZAZMWCS-UKTHLTGXSA-N. The full InChI is InChI=1S/C12H21NO/c1-10-6-4-8-12(2,3)11(10)7-5-9-13-14/h6,9,11,14H,4-5,7-8H2,1-3H3/b13-9+.
What are the key properties of (NE)-N-[3-(2,6,6-trimethylcyclohex-2-en-1-yl)propylidene]hydroxylamine?
(NE)-N-[3-(2,6,6-trimethylcyclohex-2-en-1-yl)propylidene]hydroxylamine has a molecular weight of 195.31 g/mol, XLogP of 3.61, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (NE)-N-[3-(2,6,6-trimethylcyclohex-2-en-1-yl)propylidene]hydroxylamine is sourced from PubChem (CID 10535856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).