C10H15N5O4S — CID 105359060
4-(3-amino-1,5-dimethylpyrazol-4-yl)sulfonyl-3-methylpiperazine-2,6-dione (PubChem CID 105359060) has the molecular formula C10H15N5O4S and a molecular weight of 301.33 g/mol. Its IUPAC name is 4-(3-amino-1,5-dimethylpyrazol-4-yl)sulfonyl-3-methylpiperazine-2,6-dione.
| Compound Name | 4-(3-amino-1,5-dimethylpyrazol-4-yl)sulfonyl-3-methylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 105359060 |
| Molecular Formula | C10H15N5O4S |
| Molecular Weight | 301.33 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | 4-(3-amino-1,5-dimethylpyrazol-4-yl)sulfonyl-3-methylpiperazine-2,6-dione |
| SMILES | Cc1c(S(=O)(=O)N2CC(=O)NC(=O)C2C)c(N)nn1C |
| InChI | InChI=1S/C10H15N5O4S/c1-5-8(9(11)13-14(5)3)20(18,19)15-4-7(16)12-10(17)6(15)2/h6H,4H2,1-3H3,(H2,11,13)(H,12,16,17) |
| InChIKey | JSQNHGKZFWOWPW-UHFFFAOYSA-N |
| XLogP | -1.65 |
| TPSA | 127.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.33 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|