C9H15F3N4O2S — CID 105359160
3-amino-1,5-dimethyl-N-(4,4,4-trifluorobutyl)pyrazole-4-sulfonamide (PubChem CID 105359160) has the molecular formula C9H15F3N4O2S and a molecular weight of 300.31 g/mol. Its IUPAC name is 3-amino-1,5-dimethyl-N-(4,4,4-trifluorobutyl)pyrazole-4-sulfonamide.
| Compound Name | 3-amino-1,5-dimethyl-N-(4,4,4-trifluorobutyl)pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 105359160 |
| Molecular Formula | C9H15F3N4O2S |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 3-amino-1,5-dimethyl-N-(4,4,4-trifluorobutyl)pyrazole-4-sulfonamide |
| SMILES | Cc1c(S(=O)(=O)NCCCC(F)(F)F)c(N)nn1C |
| InChI | InChI=1S/C9H15F3N4O2S/c1-6-7(8(13)15-16(6)2)19(17,18)14-5-3-4-9(10,11)12/h14H,3-5H2,1-2H3,(H2,13,15) |
| InChIKey | IAFVMKKDJSXAGJ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|