C10H17F3N4O2S — CID 105359161
3-amino-1,5-dimethyl-N-(5,5,5-trifluoropentyl)pyrazole-4-sulfonamide (PubChem CID 105359161) has the molecular formula C10H17F3N4O2S and a molecular weight of 314.33 g/mol. Its IUPAC name is 3-amino-1,5-dimethyl-N-(5,5,5-trifluoropentyl)pyrazole-4-sulfonamide.
| Compound Name | 3-amino-1,5-dimethyl-N-(5,5,5-trifluoropentyl)pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 105359161 |
| Molecular Formula | C10H17F3N4O2S |
| Molecular Weight | 314.33 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | 3-amino-1,5-dimethyl-N-(5,5,5-trifluoropentyl)pyrazole-4-sulfonamide |
| SMILES | Cc1c(S(=O)(=O)NCCCCC(F)(F)F)c(N)nn1C |
| InChI | InChI=1S/C10H17F3N4O2S/c1-7-8(9(14)16-17(7)2)20(18,19)15-6-4-3-5-10(11,12)13/h15H,3-6H2,1-2H3,(H2,14,16) |
| InChIKey | GOHQKNFFUXVGAS-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.33 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|