4-methoxycarbonyl-1,5-dimethylpyrazole-3-carboxylic acid

C8H10N2O4 — CID 10535943

IUPAC4-methoxycarbonyl-1,5-dimethylpyrazole-3-carboxylic acid
SMILESCOC(=O)c1c(C(=O)O)nn(C)c1C
InChIInChI=1S/C8H10N2O4/c1-4-5(8(13)14-3)6(7(11)12)9-10(4)2/h1-3H3,(H,11,12)
InChIKeyXFCBILKZFSPBCH-UHFFFAOYSA-N
MW198.18 g/mol
LogP0.21
Rot. Bonds2

About 4-methoxycarbonyl-1,5-dimethylpyrazole-3-carboxylic acid

4-methoxycarbonyl-1,5-dimethylpyrazole-3-carboxylic acid (PubChem CID 10535943) has the molecular formula C8H10N2O4 and a molecular weight of 198.18 g/mol. Its IUPAC name is 4-methoxycarbonyl-1,5-dimethylpyrazole-3-carboxylic acid.

Molecular Properties

Compound Name4-methoxycarbonyl-1,5-dimethylpyrazole-3-carboxylic acid
PubChem CID10535943
Molecular FormulaC8H10N2O4
Molecular Weight198.18 g/mol
Exact Mass198.06
IUPAC Name4-methoxycarbonyl-1,5-dimethylpyrazole-3-carboxylic acid
SMILESCOC(=O)c1c(C(=O)O)nn(C)c1C
InChIInChI=1S/C8H10N2O4/c1-4-5(8(13)14-3)6(7(11)12)9-10(4)2/h1-3H3,(H,11,12)
InChIKeyXFCBILKZFSPBCH-UHFFFAOYSA-N
XLogP0.21
TPSA81.42 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500198.18
LogP ≤ 50.21
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 4-methoxycarbonyl-1,5-dimethylpyrazole-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-methoxycarbonyl-1,5-dimethylpyrazole-3-carboxylic acid?
The IUPAC name of 4-methoxycarbonyl-1,5-dimethylpyrazole-3-carboxylic acid (CID 10535943) is 4-methoxycarbonyl-1,5-dimethylpyrazole-3-carboxylic acid.
What is the SMILES notation for 4-methoxycarbonyl-1,5-dimethylpyrazole-3-carboxylic acid?
The canonical SMILES for 4-methoxycarbonyl-1,5-dimethylpyrazole-3-carboxylic acid is COC(=O)c1c(C(=O)O)nn(C)c1C.
What is the InChIKey of 4-methoxycarbonyl-1,5-dimethylpyrazole-3-carboxylic acid?
The InChIKey is XFCBILKZFSPBCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O4/c1-4-5(8(13)14-3)6(7(11)12)9-10(4)2/h1-3H3,(H,11,12).
What are the key properties of 4-methoxycarbonyl-1,5-dimethylpyrazole-3-carboxylic acid?
4-methoxycarbonyl-1,5-dimethylpyrazole-3-carboxylic acid has a molecular weight of 198.18 g/mol, XLogP of 0.21, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxycarbonyl-1,5-dimethylpyrazole-3-carboxylic acid is sourced from PubChem (CID 10535943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).