C9H15F3N4O — CID 105359653
1-[1-[3-(2,2,2-trifluoroethoxy)propyl]-1,2,4-triazol-3-yl]ethanamine (PubChem CID 105359653) has the molecular formula C9H15F3N4O and a molecular weight of 252.24 g/mol. Its IUPAC name is 1-[1-[3-(2,2,2-trifluoroethoxy)propyl]-1,2,4-triazol-3-yl]ethanamine.
| Compound Name | 1-[1-[3-(2,2,2-trifluoroethoxy)propyl]-1,2,4-triazol-3-yl]ethanamine |
|---|---|
| PubChem CID | 105359653 |
| Molecular Formula | C9H15F3N4O |
| Molecular Weight | 252.24 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | 1-[1-[3-(2,2,2-trifluoroethoxy)propyl]-1,2,4-triazol-3-yl]ethanamine |
| SMILES | CC(N)c1ncn(CCCOCC(F)(F)F)n1 |
| InChI | InChI=1S/C9H15F3N4O/c1-7(13)8-14-6-16(15-8)3-2-4-17-5-9(10,11)12/h6-7H,2-5,13H2,1H3 |
| InChIKey | UPUNOIFOGADJFI-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.24 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|