About 5-[(4S)-2,2,4-trimethyl-1,3-dioxolan-4-yl]pentan-2-one
5-[(4S)-2,2,4-trimethyl-1,3-dioxolan-4-yl]pentan-2-one (PubChem CID 10536039) has the molecular formula C11H20O3
and a molecular weight of 200.28 g/mol. Its IUPAC name is 5-[(4S)-2,2,4-trimethyl-1,3-dioxolan-4-yl]pentan-2-one.
Molecular Properties
| Compound Name | 5-[(4S)-2,2,4-trimethyl-1,3-dioxolan-4-yl]pentan-2-one |
| PubChem CID | 10536039 |
| Molecular Formula | C11H20O3 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | 5-[(4S)-2,2,4-trimethyl-1,3-dioxolan-4-yl]pentan-2-one |
| SMILES | CC(=O)CCC[C@@]1(C)COC(C)(C)O1 |
| InChI | InChI=1S/C11H20O3/c1-9(12)6-5-7-11(4)8-13-10(2,3)14-11/h5-8H2,1-4H3/t11-/m0/s1 |
| InChIKey | MPNNZKMDAYJLBY-NSHDSACASA-N |
| XLogP | 2.29 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[(4S)-2,2,4-trimethyl-1,3-dioxolan-4-yl]pentan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(4S)-2,2,4-trimethyl-1,3-dioxolan-4-yl]pentan-2-one?
The IUPAC name of 5-[(4S)-2,2,4-trimethyl-1,3-dioxolan-4-yl]pentan-2-one (CID 10536039) is 5-[(4S)-2,2,4-trimethyl-1,3-dioxolan-4-yl]pentan-2-one.
What is the SMILES notation for 5-[(4S)-2,2,4-trimethyl-1,3-dioxolan-4-yl]pentan-2-one?
The canonical SMILES for 5-[(4S)-2,2,4-trimethyl-1,3-dioxolan-4-yl]pentan-2-one is CC(=O)CCC[C@@]1(C)COC(C)(C)O1.
What is the InChIKey of 5-[(4S)-2,2,4-trimethyl-1,3-dioxolan-4-yl]pentan-2-one?
The InChIKey is MPNNZKMDAYJLBY-NSHDSACASA-N. The full InChI is InChI=1S/C11H20O3/c1-9(12)6-5-7-11(4)8-13-10(2,3)14-11/h5-8H2,1-4H3/t11-/m0/s1.
What are the key properties of 5-[(4S)-2,2,4-trimethyl-1,3-dioxolan-4-yl]pentan-2-one?
5-[(4S)-2,2,4-trimethyl-1,3-dioxolan-4-yl]pentan-2-one has a molecular weight of 200.28 g/mol, XLogP of 2.29, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(4S)-2,2,4-trimethyl-1,3-dioxolan-4-yl]pentan-2-one is sourced from PubChem (CID 10536039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).