C14H19NO4S — CID 105360943
3-[4-(cyclopentylsulfonylamino)phenyl]propanoic acid (PubChem CID 105360943) has the molecular formula C14H19NO4S and a molecular weight of 297.38 g/mol. Its IUPAC name is 3-[4-(cyclopentylsulfonylamino)phenyl]propanoic acid.
| Compound Name | 3-[4-(cyclopentylsulfonylamino)phenyl]propanoic acid |
|---|---|
| PubChem CID | 105360943 |
| Molecular Formula | C14H19NO4S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 3-[4-(cyclopentylsulfonylamino)phenyl]propanoic acid |
| SMILES | O=C(O)CCc1ccc(NS(=O)(=O)C2CCCC2)cc1 |
| InChI | InChI=1S/C14H19NO4S/c16-14(17)10-7-11-5-8-12(9-6-11)15-20(18,19)13-3-1-2-4-13/h5-6,8-9,13,15H,1-4,7,10H2,(H,16,17) |
| InChIKey | JQSQODFEDBMBNI-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |