About N-[4-(1-hydroxyethyl)-1,3-thiazol-2-yl]cyclopentanesulfonamide
N-[4-(1-hydroxyethyl)-1,3-thiazol-2-yl]cyclopentanesulfonamide (PubChem CID 105361317) has the molecular formula C10H16N2O3S2
and a molecular weight of 276.38 g/mol. Its IUPAC name is N-[4-(1-hydroxyethyl)-1,3-thiazol-2-yl]cyclopentanesulfonamide.
Molecular Properties
| Compound Name | N-[4-(1-hydroxyethyl)-1,3-thiazol-2-yl]cyclopentanesulfonamide |
| PubChem CID | 105361317 |
| Molecular Formula | C10H16N2O3S2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | N-[4-(1-hydroxyethyl)-1,3-thiazol-2-yl]cyclopentanesulfonamide |
| SMILES | CC(O)c1csc(NS(=O)(=O)C2CCCC2)n1 |
| InChI | InChI=1S/C10H16N2O3S2/c1-7(13)9-6-16-10(11-9)12-17(14,15)8-4-2-3-5-8/h6-8,13H,2-5H2,1H3,(H,11,12) |
| InChIKey | NSNXYSYRPJAHBD-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[4-(1-hydroxyethyl)-1,3-thiazol-2-yl]cyclopentanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(1-hydroxyethyl)-1,3-thiazol-2-yl]cyclopentanesulfonamide?
The IUPAC name of N-[4-(1-hydroxyethyl)-1,3-thiazol-2-yl]cyclopentanesulfonamide (CID 105361317) is N-[4-(1-hydroxyethyl)-1,3-thiazol-2-yl]cyclopentanesulfonamide.
What is the SMILES notation for N-[4-(1-hydroxyethyl)-1,3-thiazol-2-yl]cyclopentanesulfonamide?
The canonical SMILES for N-[4-(1-hydroxyethyl)-1,3-thiazol-2-yl]cyclopentanesulfonamide is CC(O)c1csc(NS(=O)(=O)C2CCCC2)n1.
What is the InChIKey of N-[4-(1-hydroxyethyl)-1,3-thiazol-2-yl]cyclopentanesulfonamide?
The InChIKey is NSNXYSYRPJAHBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O3S2/c1-7(13)9-6-16-10(11-9)12-17(14,15)8-4-2-3-5-8/h6-8,13H,2-5H2,1H3,(H,11,12).
What are the key properties of N-[4-(1-hydroxyethyl)-1,3-thiazol-2-yl]cyclopentanesulfonamide?
N-[4-(1-hydroxyethyl)-1,3-thiazol-2-yl]cyclopentanesulfonamide has a molecular weight of 276.38 g/mol, XLogP of 1.88, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(1-hydroxyethyl)-1,3-thiazol-2-yl]cyclopentanesulfonamide is sourced from PubChem (CID 105361317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).